C33H41N5O3 — CID 25112245
tert-butyl N-[5-[2-anilino-4-[2-(benzylamino)-2-oxoethyl]-4H-quinazolin-3-yl]pentyl]carbamate (PubChem CID 25112245) has the molecular formula C33H41N5O3 and a molecular weight of 555.72 g/mol. Its IUPAC name is tert-butyl N-[5-[2-anilino-4-[2-(benzylamino)-2-oxoethyl]-4H-quinazolin-3-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-anilino-4-[2-(benzylamino)-2-oxoethyl]-4H-quinazolin-3-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 25112245 |
| Molecular Formula | C33H41N5O3 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | tert-butyl N-[5-[2-anilino-4-[2-(benzylamino)-2-oxoethyl]-4H-quinazolin-3-yl]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCN1C(Nc2ccccc2)=Nc2ccccc2C1CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H41N5O3/c1-33(2,3)41-32(40)34-21-13-6-14-22-38-29(23-30(39)35-24-25-15-7-4-8-16-25)27-19-11-12-20-28(27)37-31(38)36-26-17-9-5-10-18-26/h4-5,7-12,15-20,29H,6,13-14,21-24H2,1-3H3,(H,34,40)(H,35,39)(H,36,37) |
| InChIKey | OLOBWROGPOMSIZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|