C21H21NO3S — CID 25112301
(2R,3R)-2-benzylsulfanyl-3-(2,5-dioxopyrrolidin-1-yl)-3-(4-methylphenyl)propanal (PubChem CID 25112301) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is (2R,3R)-2-benzylsulfanyl-3-(2,5-dioxopyrrolidin-1-yl)-3-(4-methylphenyl)propanal.
| Compound Name | (2R,3R)-2-benzylsulfanyl-3-(2,5-dioxopyrrolidin-1-yl)-3-(4-methylphenyl)propanal |
|---|---|
| PubChem CID | 25112301 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (2R,3R)-2-benzylsulfanyl-3-(2,5-dioxopyrrolidin-1-yl)-3-(4-methylphenyl)propanal |
| SMILES | Cc1ccc([C@H]([C@H](C=O)SCc2ccccc2)N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-15-7-9-17(10-8-15)21(22-19(24)11-12-20(22)25)18(13-23)26-14-16-5-3-2-4-6-16/h2-10,13,18,21H,11-12,14H2,1H3/t18-,21+/m0/s1 |
| InChIKey | OUFCICOWGBNYAG-GHTZIAJQSA-N |
| XLogP | 3.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|