C17H22N2O5S — CID 2511239
[2-(cyclopropylamino)-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2511239) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2511239 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1)NC1CC1 |
| InChI | InChI=1S/C17H22N2O5S/c20-16(18-14-7-8-14)12-24-17(21)13-5-4-6-15(11-13)25(22,23)19-9-2-1-3-10-19/h4-6,11,14H,1-3,7-10,12H2,(H,18,20) |
| InChIKey | YTFIXJTZRPBROW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |