About [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate
[2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 2511241) has the molecular formula C18H23NO4
and a molecular weight of 317.38 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate.
Molecular Properties
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
| PubChem CID | 2511241 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C18H23NO4/c1-13(20)15-8-4-5-9-16(15)19-17(21)12-23-18(22)11-10-14-6-2-3-7-14/h4-5,8-9,14H,2-3,6-7,10-12H2,1H3,(H,19,21) |
| InChIKey | UEJJLRJBIYHCLS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate?
The IUPAC name of [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate (CID 2511241) is [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate.
What is the SMILES notation for [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate?
The canonical SMILES for [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate is CC(=O)c1ccccc1NC(=O)COC(=O)CCC1CCCC1.
What is the InChIKey of [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate?
The InChIKey is UEJJLRJBIYHCLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO4/c1-13(20)15-8-4-5-9-16(15)19-17(21)12-23-18(22)11-10-14-6-2-3-7-14/h4-5,8-9,14H,2-3,6-7,10-12H2,1H3,(H,19,21).
What are the key properties of [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate?
[2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate has a molecular weight of 317.38 g/mol, XLogP of 3.34, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-acetylanilino)-2-oxoethyl] 3-cyclopentylpropanoate is sourced from PubChem (CID 2511241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).