C14H28O2Si — CID 25112422
(3R)-3-methyl-5-triethylsilyloxyhept-6-enal (PubChem CID 25112422) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is (3R)-3-methyl-5-triethylsilyloxyhept-6-enal.
| Compound Name | (3R)-3-methyl-5-triethylsilyloxyhept-6-enal |
|---|---|
| PubChem CID | 25112422 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (3R)-3-methyl-5-triethylsilyloxyhept-6-enal |
| SMILES | C=CC(C[C@@H](C)CC=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C14H28O2Si/c1-6-14(12-13(5)10-11-15)16-17(7-2,8-3)9-4/h6,11,13-14H,1,7-10,12H2,2-5H3/t13-,14?/m0/s1 |
| InChIKey | KZCSECBWHOSCJK-LSLKUGRBSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|