About CID 25112651
CID 25112651 (PubChem CID 25112651) has the molecular formula C19H13Br2FeNO+2
and a molecular weight of 486.97 g/mol.
Molecular Properties
| Compound Name | CID 25112651 |
| PubChem CID | 25112651 |
| Molecular Formula | C19H13Br2FeNO+2 |
| Molecular Weight | 486.97 g/mol |
| Exact Mass | 484.87 |
| IUPAC Name | — |
| SMILES | O=C1Nc2cc(Br)cc(Br)c2/C1=C\[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C14H8Br2NO.C5H5.Fe/c15-9-6-11(16)13-10(5-8-3-1-2-4-8)14(18)17-12(13)7-9;1-2-4-5-3-1;/h1-7H,(H,17,18);1-5H;/q;;+2/b10-5+;; |
| InChIKey | HOIXZQMBIVGJJF-XKYXOGKGSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 25112651 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25112651?
The IUPAC name of CID 25112651 (CID 25112651) is not available.
What is the SMILES notation for CID 25112651?
The canonical SMILES for CID 25112651 is O=C1Nc2cc(Br)cc(Br)c2/C1=C\[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 25112651?
The InChIKey is HOIXZQMBIVGJJF-XKYXOGKGSA-N. The full InChI is InChI=1S/C14H8Br2NO.C5H5.Fe/c15-9-6-11(16)13-10(5-8-3-1-2-4-8)14(18)17-12(13)7-9;1-2-4-5-3-1;/h1-7H,(H,17,18);1-5H;/q;;+2/b10-5+;;.
What are the key properties of CID 25112651?
CID 25112651 has a molecular weight of 486.97 g/mol, XLogP of 4.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25112651 is sourced from PubChem (CID 25112651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).