C16H21NO7 — CID 25112839
(4S,6S,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-3-methyl-4-phenyl-1,7-dioxa-3-azaspiro[5.5]undecan-2-one (PubChem CID 25112839) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is (4S,6S,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-3-methyl-4-phenyl-1,7-dioxa-3-azaspiro[5.5]undecan-2-one.
| Compound Name | (4S,6S,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-3-methyl-4-phenyl-1,7-dioxa-3-azaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 25112839 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (4S,6S,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-3-methyl-4-phenyl-1,7-dioxa-3-azaspiro[5.5]undecan-2-one |
| SMILES | CN1C(=O)O[C@]2(C[C@H]1c1ccccc1)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C16H21NO7/c1-17-10(9-5-3-2-4-6-9)7-16(24-15(17)22)14(21)13(20)12(19)11(8-18)23-16/h2-6,10-14,18-21H,7-8H2,1H3/t10-,11+,12+,13-,14+,16-/m0/s1 |
| InChIKey | QBSHYOSTVITZNU-OTJBPAGCSA-N |
| XLogP | -0.63 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |