About N-hexylhexanamide
N-hexylhexanamide (PubChem CID 25113) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is N-hexylhexanamide.
Molecular Properties
| Compound Name | N-hexylhexanamide |
| PubChem CID | 25113 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N-hexylhexanamide |
| SMILES | CCCCCCNC(=O)CCCCC |
| InChI | InChI=1S/C12H25NO/c1-3-5-7-9-11-13-12(14)10-8-6-4-2/h3-11H2,1-2H3,(H,13,14) |
| InChIKey | CKQIYVUVMRSSLI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexylhexanamide?
The IUPAC name of N-hexylhexanamide (CID 25113) is N-hexylhexanamide.
What is the SMILES notation for N-hexylhexanamide?
The canonical SMILES for N-hexylhexanamide is CCCCCCNC(=O)CCCCC.
What is the InChIKey of N-hexylhexanamide?
The InChIKey is CKQIYVUVMRSSLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-3-5-7-9-11-13-12(14)10-8-6-4-2/h3-11H2,1-2H3,(H,13,14).
What are the key properties of N-hexylhexanamide?
N-hexylhexanamide has a molecular weight of 199.34 g/mol, XLogP of 3.26, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexylhexanamide is sourced from PubChem (CID 25113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).