C11H20O7 — CID 25113108
(2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxy-2-propoxyoxane-2-carbaldehyde (PubChem CID 25113108) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxy-2-propoxyoxane-2-carbaldehyde.
| Compound Name | (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxy-2-propoxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 25113108 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxy-2-propoxyoxane-2-carbaldehyde |
| SMILES | CCCO[C@]1(C=O)C[C@@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O1 |
| InChI | InChI=1S/C11H20O7/c1-2-3-17-11(6-13)4-7(14)9(16)10(18-11)8(15)5-12/h6-10,12,14-16H,2-5H2,1H3/t7-,8-,9-,10-,11-/m1/s1 |
| InChIKey | IBFZNVSFIROBGB-ISUQUUIWSA-N |
| XLogP | -1.83 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|