C8H14O9 — CID 25113109
(2R,3S,4S,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,3,4,5-tetrahydroxyoxane-2-carboxylic acid (PubChem CID 25113109) has the molecular formula C8H14O9 and a molecular weight of 254.19 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,3,4,5-tetrahydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,3S,4S,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,3,4,5-tetrahydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 25113109 |
| Molecular Formula | C8H14O9 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (2R,3S,4S,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,3,4,5-tetrahydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@]1(O)O[C@H]([C@H](O)CO)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14O9/c9-1-2(10)5-3(11)4(12)6(13)8(16,17-5)7(14)15/h2-6,9-13,16H,1H2,(H,14,15)/t2-,3-,4+,5-,6+,8-/m1/s1 |
| InChIKey | GQQWVQCNFJXTNV-CXERMUKYSA-N |
| XLogP | -4.41 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |