C33H38N6O4 — CID 25113175
N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)-2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidine-5-carboxamide (PubChem CID 25113175) has the molecular formula C33H38N6O4 and a molecular weight of 582.71 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)-2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidine-5-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)-2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 25113175 |
| Molecular Formula | C33H38N6O4 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-(2-ethoxyphenoxy)-2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidine-5-carboxamide |
| SMILES | CCOc1ccccc1Oc1nc(Nc2ccc(N3CCN(CCO)CC3)cc2)ncc1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C33H38N6O4/c1-4-42-28-10-5-6-11-29(28)43-32-27(31(41)36-30-23(2)8-7-9-24(30)3)22-34-33(37-32)35-25-12-14-26(15-13-25)39-18-16-38(17-19-39)20-21-40/h5-15,22,40H,4,16-21H2,1-3H3,(H,36,41)(H,34,35,37) |
| InChIKey | QFKVGNGFBPPYQL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|