C7H9Cl3Si — CID 25113252
[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-trichlorosilane (PubChem CID 25113252) has the molecular formula C7H9Cl3Si and a molecular weight of 227.59 g/mol. Its IUPAC name is [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-trichlorosilane.
| Compound Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-trichlorosilane |
|---|---|
| PubChem CID | 25113252 |
| Molecular Formula | C7H9Cl3Si |
| Molecular Weight | 227.59 g/mol |
| Exact Mass | 225.95 |
| IUPAC Name | [(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-trichlorosilane |
| SMILES | Cl[Si](Cl)(Cl)[C@@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C7H9Cl3Si/c8-11(9,10)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2/t5-,6+,7+/m0/s1 |
| InChIKey | RDAOXVBXDCANBV-RRKCRQDMSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|