About trichloroneodymium;trichloropraseodymium
trichloroneodymium;trichloropraseodymium (PubChem CID 25113348) has the molecular formula Cl6NdPr
and a molecular weight of 497.87 g/mol. Its IUPAC name is trichloroneodymium;trichloropraseodymium.
Molecular Properties
| Compound Name | trichloroneodymium;trichloropraseodymium |
| PubChem CID | 25113348 |
| Molecular Formula | Cl6NdPr |
| Molecular Weight | 497.87 g/mol |
| Exact Mass | 492.63 |
| IUPAC Name | trichloroneodymium;trichloropraseodymium |
| SMILES | Cl[Nd](Cl)Cl.Cl[Pr](Cl)Cl |
| InChI | InChI=1S/6ClH.Nd.Pr/h6*1H;;/q;;;;;;2*+3/p-6 |
| InChIKey | WTQUHLHXFJEOTI-UHFFFAOYSA-H |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trichloroneodymium;trichloropraseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloroneodymium;trichloropraseodymium?
The IUPAC name of trichloroneodymium;trichloropraseodymium (CID 25113348) is trichloroneodymium;trichloropraseodymium.
What is the SMILES notation for trichloroneodymium;trichloropraseodymium?
The canonical SMILES for trichloroneodymium;trichloropraseodymium is Cl[Nd](Cl)Cl.Cl[Pr](Cl)Cl.
What is the InChIKey of trichloroneodymium;trichloropraseodymium?
The InChIKey is WTQUHLHXFJEOTI-UHFFFAOYSA-H. The full InChI is InChI=1S/6ClH.Nd.Pr/h6*1H;;/q;;;;;;2*+3/p-6.
What are the key properties of trichloroneodymium;trichloropraseodymium?
trichloroneodymium;trichloropraseodymium has a molecular weight of 497.87 g/mol, XLogP of 4.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloroneodymium;trichloropraseodymium is sourced from PubChem (CID 25113348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).