C22H14I2O5 — CID 25113374
3',6'-dihydroxy-4',5'-diiodo-2',7'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 25113374) has the molecular formula C22H14I2O5 and a molecular weight of 612.16 g/mol. Its IUPAC name is 3',6'-dihydroxy-4',5'-diiodo-2',7'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-dihydroxy-4',5'-diiodo-2',7'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 25113374 |
| Molecular Formula | C22H14I2O5 |
| Molecular Weight | 612.16 g/mol |
| Exact Mass | 611.89 |
| IUPAC Name | 3',6'-dihydroxy-4',5'-diiodo-2',7'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Cc1cc2c(c(I)c1O)Oc1c(cc(C)c(O)c1I)C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C22H14I2O5/c1-9-7-13-19(15(23)17(9)25)28-20-14(8-10(2)18(26)16(20)24)22(13)12-6-4-3-5-11(12)21(27)29-22/h3-8,25-26H,1-2H3 |
| InChIKey | RPSDBCNTVXHSII-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.16 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|