About iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole
iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole (PubChem CID 25113429) has the molecular formula C14H15IN2O
and a molecular weight of 354.19 g/mol. Its IUPAC name is iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| PubChem CID | 25113429 |
| Molecular Formula | C14H15IN2O |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| SMILES | CI.COc1ccc2c(c1)[nH]c1c(C)nccc12 |
| InChI | InChI=1S/C13H12N2O.CH3I/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;1-2/h3-7,15H,1-2H3;1H3 |
| InChIKey | YVRMAEPTYDRNPF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole?
The IUPAC name of iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole (CID 25113429) is iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole.
What is the SMILES notation for iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole?
The canonical SMILES for iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole is CI.COc1ccc2c(c1)[nH]c1c(C)nccc12.
What is the InChIKey of iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole?
The InChIKey is YVRMAEPTYDRNPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O.CH3I/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;1-2/h3-7,15H,1-2H3;1H3.
What are the key properties of iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole?
iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole has a molecular weight of 354.19 g/mol, XLogP of 4.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethane;7-methoxy-1-methyl-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 25113429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).