About [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 2511362) has the molecular formula C20H16N2O5
and a molecular weight of 364.36 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate |
| PubChem CID | 2511362 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)N2CC(=O)Nc3ccccc32)oc2ccccc12 |
| InChI | InChI=1S/C20H16N2O5/c1-12-13-6-2-5-9-16(13)27-19(12)20(25)26-11-18(24)22-10-17(23)21-14-7-3-4-8-15(14)22/h2-9H,10-11H2,1H3,(H,21,23) |
| InChIKey | HKBDNMXFGXQXNM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate?
The IUPAC name of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate (CID 2511362) is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate.
What is the SMILES notation for [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate?
The canonical SMILES for [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate is Cc1c(C(=O)OCC(=O)N2CC(=O)Nc3ccccc32)oc2ccccc12.
What is the InChIKey of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate?
The InChIKey is HKBDNMXFGXQXNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O5/c1-12-13-6-2-5-9-16(13)27-19(12)20(25)26-11-18(24)22-10-17(23)21-14-7-3-4-8-15(14)22/h2-9H,10-11H2,1H3,(H,21,23).
What are the key properties of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate?
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate has a molecular weight of 364.36 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-methyl-1-benzofuran-2-carboxylate is sourced from PubChem (CID 2511362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).