About 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol
6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol (PubChem CID 25113763) has the molecular formula C9H9ClN2O
and a molecular weight of 196.64 g/mol. Its IUPAC name is 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol.
Molecular Properties
| Compound Name | 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol |
| PubChem CID | 25113763 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol |
| SMILES | Cc1nc2c(O)cc(Cl)cn2c1C |
| InChI | InChI=1S/C9H9ClN2O/c1-5-6(2)12-4-7(10)3-8(13)9(12)11-5/h3-4,13H,1-2H3 |
| InChIKey | JJTUIIUDUVKJDA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol?
The IUPAC name of 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol (CID 25113763) is 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol.
What is the SMILES notation for 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol?
The canonical SMILES for 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol is Cc1nc2c(O)cc(Cl)cn2c1C.
What is the InChIKey of 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol?
The InChIKey is JJTUIIUDUVKJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O/c1-5-6(2)12-4-7(10)3-8(13)9(12)11-5/h3-4,13H,1-2H3.
What are the key properties of 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol?
6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol has a molecular weight of 196.64 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3-dimethylimidazo[1,2-a]pyridin-8-ol is sourced from PubChem (CID 25113763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).