C15H12N2O2 — CID 25113764
(4Z)-4-[(1-methylpyrrol-2-yl)methylidene]isoquinoline-1,3-dione (PubChem CID 25113764) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is (4Z)-4-[(1-methylpyrrol-2-yl)methylidene]isoquinoline-1,3-dione.
| Compound Name | (4Z)-4-[(1-methylpyrrol-2-yl)methylidene]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 25113764 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (4Z)-4-[(1-methylpyrrol-2-yl)methylidene]isoquinoline-1,3-dione |
| SMILES | Cn1cccc1/C=C1\C(=O)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C15H12N2O2/c1-17-8-4-5-10(17)9-13-11-6-2-3-7-12(11)14(18)16-15(13)19/h2-9H,1H3,(H,16,18,19)/b13-9- |
| InChIKey | BTYSIDSTHDDAJW-LCYFTJDESA-N |
| XLogP | 1.84 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|