C22H17ClN4O4 — CID 25113840
2-(2-chloro-6-nitrophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 25113840) has the molecular formula C22H17ClN4O4 and a molecular weight of 436.86 g/mol. Its IUPAC name is 2-(2-chloro-6-nitrophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(2-chloro-6-nitrophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 25113840 |
| Molecular Formula | C22H17ClN4O4 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-(2-chloro-6-nitrophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1ccc2nc(-c3c(Cl)cccc3[N+](=O)[O-])c(Nc3ccc4c(c3)OCCO4)n2c1 |
| InChI | InChI=1S/C22H17ClN4O4/c1-13-5-8-19-25-21(20-15(23)3-2-4-16(20)27(28)29)22(26(19)12-13)24-14-6-7-17-18(11-14)31-10-9-30-17/h2-8,11-12,24H,9-10H2,1H3 |
| InChIKey | MTLJDYKXBFVKHA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|