C16H14N2O6S — CID 25113849
2-(1,1-dioxo-2-phenyl-3H-[1,3]dioxolo[4,5-f][1,2]benzothiazol-3-yl)-N-hydroxyacetamide (PubChem CID 25113849) has the molecular formula C16H14N2O6S and a molecular weight of 362.36 g/mol. Its IUPAC name is 2-(1,1-dioxo-2-phenyl-3H-[1,3]dioxolo[4,5-f][1,2]benzothiazol-3-yl)-N-hydroxyacetamide.
| Compound Name | 2-(1,1-dioxo-2-phenyl-3H-[1,3]dioxolo[4,5-f][1,2]benzothiazol-3-yl)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 25113849 |
| Molecular Formula | C16H14N2O6S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-(1,1-dioxo-2-phenyl-3H-[1,3]dioxolo[4,5-f][1,2]benzothiazol-3-yl)-N-hydroxyacetamide |
| SMILES | O=C(CC1c2cc3c(cc2S(=O)(=O)N1c1ccccc1)OCO3)NO |
| InChI | InChI=1S/C16H14N2O6S/c19-16(17-20)7-12-11-6-13-14(24-9-23-13)8-15(11)25(21,22)18(12)10-4-2-1-3-5-10/h1-6,8,12,20H,7,9H2,(H,17,19) |
| InChIKey | WRPNYJSOUWBPNH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|