C30H35FN2O5 — CID 25113865
4-[4-(3-fluorophenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol (PubChem CID 25113865) has the molecular formula C30H35FN2O5 and a molecular weight of 522.62 g/mol. Its IUPAC name is 4-[4-(3-fluorophenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol.
| Compound Name | 4-[4-(3-fluorophenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol |
|---|---|
| PubChem CID | 25113865 |
| Molecular Formula | C30H35FN2O5 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 4-[4-(3-fluorophenoxy)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-3-ol |
| SMILES | COCCCN1CCOc2ccc(COC3CNCC(O)C3c3ccc(Oc4cccc(F)c4)cc3)cc21 |
| InChI | InChI=1S/C30H35FN2O5/c1-35-14-3-12-33-13-15-36-28-11-6-21(16-26(28)33)20-37-29-19-32-18-27(34)30(29)22-7-9-24(10-8-22)38-25-5-2-4-23(31)17-25/h2,4-11,16-17,27,29-30,32,34H,3,12-15,18-20H2,1H3 |
| InChIKey | QIQQFZSIXHWLIK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|