About 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid
3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid (PubChem CID 25113999) has the molecular formula C20H21Cl2NO4
and a molecular weight of 410.30 g/mol. Its IUPAC name is 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid.
Molecular Properties
| Compound Name | 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid |
| PubChem CID | 25113999 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1cccc(/C(C)=N/OCc2ccc(Cl)cc2Cl)c1)C(=O)O |
| InChI | InChI=1S/C20H21Cl2NO4/c1-3-26-19(20(24)25)10-14-5-4-6-15(9-14)13(2)23-27-12-16-7-8-17(21)11-18(16)22/h4-9,11,19H,3,10,12H2,1-2H3,(H,24,25)/b23-13+ |
| InChIKey | GHRAJZKMYCHFBC-YDZHTSKRSA-N |
| XLogP | 4.97 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid?
The IUPAC name of 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid (CID 25113999) is 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid.
What is the SMILES notation for 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid?
The canonical SMILES for 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid is CCOC(Cc1cccc(/C(C)=N/OCc2ccc(Cl)cc2Cl)c1)C(=O)O.
What is the InChIKey of 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid?
The InChIKey is GHRAJZKMYCHFBC-YDZHTSKRSA-N. The full InChI is InChI=1S/C20H21Cl2NO4/c1-3-26-19(20(24)25)10-14-5-4-6-15(9-14)13(2)23-27-12-16-7-8-17(21)11-18(16)22/h4-9,11,19H,3,10,12H2,1-2H3,(H,24,25)/b23-13+.
What are the key properties of 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid?
3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid has a molecular weight of 410.30 g/mol, XLogP of 4.97, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(E)-N-[(2,4-dichlorophenyl)methoxy]-C-methylcarbonimidoyl]phenyl]-2-ethoxypropanoic acid is sourced from PubChem (CID 25113999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).