C33H31ClN2O11 — CID 25114164
(E)-3-[3-[(7-chloroquinolin-4-yl)amino]phenyl]-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 25114164) has the molecular formula C33H31ClN2O11 and a molecular weight of 667.07 g/mol. Its IUPAC name is (E)-3-[3-[(7-chloroquinolin-4-yl)amino]phenyl]-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | (E)-3-[3-[(7-chloroquinolin-4-yl)amino]phenyl]-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 25114164 |
| Molecular Formula | C33H31ClN2O11 |
| Molecular Weight | 667.07 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | (E)-3-[3-[(7-chloroquinolin-4-yl)amino]phenyl]-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | COc1ccc(C(=O)/C=C/c2cccc(Nc3ccnc4cc(Cl)ccc34)c2)c(OC)c1OC.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H23ClN2O4.C6H8O7/c1-32-25-12-10-21(26(33-2)27(25)34-3)24(31)11-7-17-5-4-6-19(15-17)30-22-13-14-29-23-16-18(28)8-9-20(22)23;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-16H,1-3H3,(H,29,30);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b11-7+; |
| InChIKey | SNAFGIWBCISONW-RVDQCCQOSA-N |
| XLogP | 5.31 |
| TPSA | 201.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.07 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|