C25H31BrN4O3 — CID 25114166
(2R,3S)-1-N-(4-bromophenyl)-3-methoxy-2-methyl-2-N-(2,3,3-trimethyl-1,4-dihydroisoquinolin-6-yl)azetidine-1,2-dicarboxamide (PubChem CID 25114166) has the molecular formula C25H31BrN4O3 and a molecular weight of 515.45 g/mol. Its IUPAC name is (2R,3S)-1-N-(4-bromophenyl)-3-methoxy-2-methyl-2-N-(2,3,3-trimethyl-1,4-dihydroisoquinolin-6-yl)azetidine-1,2-dicarboxamide.
| Compound Name | (2R,3S)-1-N-(4-bromophenyl)-3-methoxy-2-methyl-2-N-(2,3,3-trimethyl-1,4-dihydroisoquinolin-6-yl)azetidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 25114166 |
| Molecular Formula | C25H31BrN4O3 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | (2R,3S)-1-N-(4-bromophenyl)-3-methoxy-2-methyl-2-N-(2,3,3-trimethyl-1,4-dihydroisoquinolin-6-yl)azetidine-1,2-dicarboxamide |
| SMILES | CO[C@H]1CN(C(=O)Nc2ccc(Br)cc2)[C@@]1(C)C(=O)Nc1ccc2c(c1)CC(C)(C)N(C)C2 |
| InChI | InChI=1S/C25H31BrN4O3/c1-24(2)13-17-12-20(9-6-16(17)14-29(24)4)27-22(31)25(3)21(33-5)15-30(25)23(32)28-19-10-7-18(26)8-11-19/h6-12,21H,13-15H2,1-5H3,(H,27,31)(H,28,32)/t21-,25+/m0/s1 |
| InChIKey | URRBGODYBXVNSK-SQJMNOBHSA-N |
| XLogP | 4.48 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |