C26H33NO4 — CID 25114396
(2E,4E,6E,8E)-N-[(5-hydroxy-4-oxopyran-2-yl)methyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 25114396) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-[(5-hydroxy-4-oxopyran-2-yl)methyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-[(5-hydroxy-4-oxopyran-2-yl)methyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 25114396 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (2E,4E,6E,8E)-N-[(5-hydroxy-4-oxopyran-2-yl)methyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NCc2cc(=O)c(O)co2)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H33NO4/c1-18(11-12-22-20(3)10-7-13-26(22,4)5)8-6-9-19(2)14-25(30)27-16-21-15-23(28)24(29)17-31-21/h6,8-9,11-12,14-15,17,29H,7,10,13,16H2,1-5H3,(H,27,30)/b9-6+,12-11+,18-8+,19-14+ |
| InChIKey | XSJRZJRZMPRJOB-ZEHYRTHWSA-N |
| XLogP | 5.49 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|