About N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide
N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide (PubChem CID 25114655) has the molecular formula C22H16F2N2O
and a molecular weight of 362.38 g/mol. Its IUPAC name is N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide |
| PubChem CID | 25114655 |
| Molecular Formula | C22H16F2N2O |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2ccc(F)c(F)c2)cc(-c2cccc3[nH]ccc23)c1 |
| InChI | InChI=1S/C22H16F2N2O/c1-13(27)26-17-10-15(14-5-6-20(23)21(24)12-14)9-16(11-17)18-3-2-4-22-19(18)7-8-25-22/h2-12,25H,1H3,(H,26,27) |
| InChIKey | RRIJPSPSWGMZDS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide?
The IUPAC name of N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide (CID 25114655) is N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide.
What is the SMILES notation for N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide?
The canonical SMILES for N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide is CC(=O)Nc1cc(-c2ccc(F)c(F)c2)cc(-c2cccc3[nH]ccc23)c1.
What is the InChIKey of N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide?
The InChIKey is RRIJPSPSWGMZDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16F2N2O/c1-13(27)26-17-10-15(14-5-6-20(23)21(24)12-14)9-16(11-17)18-3-2-4-22-19(18)7-8-25-22/h2-12,25H,1H3,(H,26,27).
What are the key properties of N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide?
N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide has a molecular weight of 362.38 g/mol, XLogP of 5.74, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,4-difluorophenyl)-5-(1H-indol-4-yl)phenyl]acetamide is sourced from PubChem (CID 25114655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).