About N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide
N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide (PubChem CID 2511474) has the molecular formula C21H21N3O4
and a molecular weight of 379.42 g/mol. Its IUPAC name is N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide.
Molecular Properties
| Compound Name | N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide |
| PubChem CID | 2511474 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide |
| SMILES | CC(C)CCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3ccccc3)cc2c1O |
| InChI | InChI=1S/C21H21N3O4/c1-13(2)10-11-24-20(27)16-9-8-15(12-17(16)21(24)28)19(26)23-22-18(25)14-6-4-3-5-7-14/h3-9,12-13,27-28H,10-11H2,1-2H3/b23-22+ |
| InChIKey | AKKGHYVALYLDCX-GHVJWSGMSA-N |
| XLogP | 4.53 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide?
The IUPAC name of N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide (CID 2511474) is N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide.
What is the SMILES notation for N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide?
The canonical SMILES for N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide is CC(C)CCn1c(O)c2ccc(C(=O)/N=N/C(=O)c3ccccc3)cc2c1O.
What is the InChIKey of N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide?
The InChIKey is AKKGHYVALYLDCX-GHVJWSGMSA-N. The full InChI is InChI=1S/C21H21N3O4/c1-13(2)10-11-24-20(27)16-9-8-15(12-17(16)21(24)28)19(26)23-22-18(25)14-6-4-3-5-7-14/h3-9,12-13,27-28H,10-11H2,1-2H3/b23-22+.
What are the key properties of N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide?
N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide has a molecular weight of 379.42 g/mol, XLogP of 4.53, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzoylimino-1,3-dihydroxy-2-(3-methylbutyl)isoindole-5-carboxamide is sourced from PubChem (CID 2511474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).