About N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide
N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide (PubChem CID 25114930) has the molecular formula C20H10Cl2F6N2O3S
and a molecular weight of 543.27 g/mol. Its IUPAC name is N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide.
Molecular Properties
| Compound Name | N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide |
| PubChem CID | 25114930 |
| Molecular Formula | C20H10Cl2F6N2O3S |
| Molecular Weight | 543.27 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)nc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H10Cl2F6N2O3S/c21-11-2-5-14(16(22)8-11)18(31)30-34(32,33)12-3-6-17(29-9-12)13-4-1-10(19(23,24)25)7-15(13)20(26,27)28/h1-9H,(H,30,31) |
| InChIKey | IBQJBHKQFXQWNM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.27 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide?
The IUPAC name of N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide (CID 25114930) is N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide.
What is the SMILES notation for N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide?
The canonical SMILES for N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide is O=C(NS(=O)(=O)c1ccc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)nc1)c1ccc(Cl)cc1Cl.
What is the InChIKey of N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide?
The InChIKey is IBQJBHKQFXQWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10Cl2F6N2O3S/c21-11-2-5-14(16(22)8-11)18(31)30-34(32,33)12-3-6-17(29-9-12)13-4-1-10(19(23,24)25)7-15(13)20(26,27)28/h1-9H,(H,30,31).
What are the key properties of N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide?
N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide has a molecular weight of 543.27 g/mol, XLogP of 6.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-[2,4-bis(trifluoromethyl)phenyl]-3-pyridinyl]sulfonyl]-2,4-dichlorobenzamide is sourced from PubChem (CID 25114930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).