C21H10F4N2O3 — CID 25115010
4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium-2-carboxylic acid (PubChem CID 25115010) has the molecular formula C21H10F4N2O3 and a molecular weight of 414.31 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium-2-carboxylic acid.
| Compound Name | 4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 25115010 |
| Molecular Formula | C21H10F4N2O3 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 4-(2,4-difluorophenyl)-8-(2,6-difluorophenyl)-7-oxido-1,7-naphthyridin-7-ium-2-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(F)cc2F)c2cc[n+]([O-])c(-c3c(F)cccc3F)c2n1 |
| InChI | InChI=1S/C21H10F4N2O3/c22-10-4-5-11(16(25)8-10)13-9-17(21(28)29)26-19-12(13)6-7-27(30)20(19)18-14(23)2-1-3-15(18)24/h1-9H,(H,28,29) |
| InChIKey | HNBZLRAOXYXRMA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|