C27H37N9OS — CID 25115273
1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-[4-(1,3-oxazol-5-yl)phenyl]thiourea (PubChem CID 25115273) has the molecular formula C27H37N9OS and a molecular weight of 535.72 g/mol. Its IUPAC name is 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-[4-(1,3-oxazol-5-yl)phenyl]thiourea.
| Compound Name | 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-[4-(1,3-oxazol-5-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 25115273 |
| Molecular Formula | C27H37N9OS |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 1-[2-[2-[(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl-methylamino]ethyl]-1-[4-(1,3-oxazol-5-yl)phenyl]thiourea |
| SMILES | CN(CCNc1cc(N2CCCC2)nc(N2CCCC2)n1)CCN(C(N)=S)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C27H37N9OS/c1-33(16-17-36(26(28)38)22-8-6-21(7-9-22)23-19-29-20-37-23)15-10-30-24-18-25(34-11-2-3-12-34)32-27(31-24)35-13-4-5-14-35/h6-9,18-20H,2-5,10-17H2,1H3,(H2,28,38)(H,30,31,32) |
| InChIKey | AHQMRLDEWNBWMX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|