C26H28FN5O3 — CID 25115525
6-(aminomethyl)-5-(5-fluoro-2-methoxyphenyl)-1,3-dimethyl-7-(3-phenylpropylamino)pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 25115525) has the molecular formula C26H28FN5O3 and a molecular weight of 477.54 g/mol. Its IUPAC name is 6-(aminomethyl)-5-(5-fluoro-2-methoxyphenyl)-1,3-dimethyl-7-(3-phenylpropylamino)pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-(aminomethyl)-5-(5-fluoro-2-methoxyphenyl)-1,3-dimethyl-7-(3-phenylpropylamino)pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25115525 |
| Molecular Formula | C26H28FN5O3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 6-(aminomethyl)-5-(5-fluoro-2-methoxyphenyl)-1,3-dimethyl-7-(3-phenylpropylamino)pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(F)cc1-c1c(CN)c(NCCCc2ccccc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C26H28FN5O3/c1-31-24-22(25(33)32(2)26(31)34)21(18-14-17(27)11-12-20(18)35-3)19(15-28)23(30-24)29-13-7-10-16-8-5-4-6-9-16/h4-6,8-9,11-12,14H,7,10,13,15,28H2,1-3H3,(H,29,30) |
| InChIKey | DVCQMSPBQAWYPJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|