About 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol
2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol (PubChem CID 25115702) has the molecular formula C17H19ClF2N2O
and a molecular weight of 340.80 g/mol. Its IUPAC name is 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol |
| PubChem CID | 25115702 |
| Molecular Formula | C17H19ClF2N2O |
| Molecular Weight | 340.80 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol |
| SMILES | CC(CCc1ccc(Cl)nc1)NCC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H19ClF2N2O/c1-11(2-3-12-4-7-17(18)22-9-12)21-10-16(23)14-6-5-13(19)8-15(14)20/h4-9,11,16,21,23H,2-3,10H2,1H3 |
| InChIKey | RFURXDCXSRMGHR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol?
The IUPAC name of 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol (CID 25115702) is 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol.
What is the SMILES notation for 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol?
The canonical SMILES for 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol is CC(CCc1ccc(Cl)nc1)NCC(O)c1ccc(F)cc1F.
What is the InChIKey of 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol?
The InChIKey is RFURXDCXSRMGHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClF2N2O/c1-11(2-3-12-4-7-17(18)22-9-12)21-10-16(23)14-6-5-13(19)8-15(14)20/h4-9,11,16,21,23H,2-3,10H2,1H3.
What are the key properties of 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol?
2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol has a molecular weight of 340.80 g/mol, XLogP of 3.66, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(6-chloro-3-pyridinyl)butan-2-ylamino]-1-(2,4-difluorophenyl)ethanol is sourced from PubChem (CID 25115702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).