C18H27NO2 — CID 25116001
(3aS,6E,10E,11aR)-10-methyl-3-methylidene-6-(propylaminomethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one (PubChem CID 25116001) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (3aS,6E,10E,11aR)-10-methyl-3-methylidene-6-(propylaminomethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one.
| Compound Name | (3aS,6E,10E,11aR)-10-methyl-3-methylidene-6-(propylaminomethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 25116001 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (3aS,6E,10E,11aR)-10-methyl-3-methylidene-6-(propylaminomethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(/CNCCC)CC[C@@H]12 |
| InChI | InChI=1S/C18H27NO2/c1-4-10-19-12-15-7-5-6-13(2)11-17-16(9-8-15)14(3)18(20)21-17/h7,11,16-17,19H,3-6,8-10,12H2,1-2H3/b13-11+,15-7+/t16-,17+/m0/s1 |
| InChIKey | SESFIXOPXLQGFY-RZNZMDGJSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|