C17H25NO3 — CID 25116002
(3aS,6E,10E,11aR)-6-[(2-hydroxyethylamino)methyl]-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one (PubChem CID 25116002) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3aS,6E,10E,11aR)-6-[(2-hydroxyethylamino)methyl]-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one.
| Compound Name | (3aS,6E,10E,11aR)-6-[(2-hydroxyethylamino)methyl]-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 25116002 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (3aS,6E,10E,11aR)-6-[(2-hydroxyethylamino)methyl]-10-methyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(/CNCCO)CC[C@@H]12 |
| InChI | InChI=1S/C17H25NO3/c1-12-4-3-5-14(11-18-8-9-19)6-7-15-13(2)17(20)21-16(15)10-12/h5,10,15-16,18-19H,2-4,6-9,11H2,1H3/b12-10+,14-5+/t15-,16+/m0/s1 |
| InChIKey | PTNWFRXTCCGKBF-UHHQIRCBSA-N |
| XLogP | 2.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|