About 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole
1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole (PubChem CID 25116047) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole.
Molecular Properties
| Compound Name | 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole |
| PubChem CID | 25116047 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole |
| SMILES | CC(C)=CCC/C(C)=C\Cn1ccnc1 |
| InChI | InChI=1S/C13H20N2/c1-12(2)5-4-6-13(3)7-9-15-10-8-14-11-15/h5,7-8,10-11H,4,6,9H2,1-3H3/b13-7- |
| InChIKey | UAGKQHUXYMRQOV-QPEQYQDCSA-N |
| XLogP | 3.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole?
The IUPAC name of 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole (CID 25116047) is 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole.
What is the SMILES notation for 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole?
The canonical SMILES for 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole is CC(C)=CCC/C(C)=C\Cn1ccnc1.
What is the InChIKey of 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole?
The InChIKey is UAGKQHUXYMRQOV-QPEQYQDCSA-N. The full InChI is InChI=1S/C13H20N2/c1-12(2)5-4-6-13(3)7-9-15-10-8-14-11-15/h5,7-8,10-11H,4,6,9H2,1-3H3/b13-7-.
What are the key properties of 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole?
1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole has a molecular weight of 204.32 g/mol, XLogP of 3.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]imidazole is sourced from PubChem (CID 25116047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).