C17H15F3N2O5S — CID 25116323
2-[1,1-dioxo-2-[4-(2,2,2-trifluoroethoxy)phenyl]-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide (PubChem CID 25116323) has the molecular formula C17H15F3N2O5S and a molecular weight of 416.38 g/mol. Its IUPAC name is 2-[1,1-dioxo-2-[4-(2,2,2-trifluoroethoxy)phenyl]-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide.
| Compound Name | 2-[1,1-dioxo-2-[4-(2,2,2-trifluoroethoxy)phenyl]-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 25116323 |
| Molecular Formula | C17H15F3N2O5S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-[1,1-dioxo-2-[4-(2,2,2-trifluoroethoxy)phenyl]-3H-1,2-benzothiazol-3-yl]-N-hydroxyacetamide |
| SMILES | O=C(CC1c2ccccc2S(=O)(=O)N1c1ccc(OCC(F)(F)F)cc1)NO |
| InChI | InChI=1S/C17H15F3N2O5S/c18-17(19,20)10-27-12-7-5-11(6-8-12)22-14(9-16(23)21-24)13-3-1-2-4-15(13)28(22,25)26/h1-8,14,24H,9-10H2,(H,21,23) |
| InChIKey | WHNSQFWHQJXJNZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|