About 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide
2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide (PubChem CID 2511656) has the molecular formula C19H14N4O4S2
and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide |
| PubChem CID | 2511656 |
| Molecular Formula | C19H14N4O4S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H14N4O4S2/c24-17-11-15(14-3-1-2-4-16(14)22-17)18(25)21-12-5-7-13(8-6-12)29(26,27)23-19-20-9-10-28-19/h1-11H,(H,20,23)(H,21,25)(H,22,24) |
| InChIKey | AVTBUFLNGRBBTC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide?
The IUPAC name of 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide (CID 2511656) is 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide.
What is the SMILES notation for 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide?
The canonical SMILES for 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide is O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1cc(=O)[nH]c2ccccc12.
What is the InChIKey of 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide?
The InChIKey is AVTBUFLNGRBBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4O4S2/c24-17-11-15(14-3-1-2-4-16(14)22-17)18(25)21-12-5-7-13(8-6-12)29(26,27)23-19-20-9-10-28-19/h1-11H,(H,20,23)(H,21,25)(H,22,24).
What are the key properties of 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide?
2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide has a molecular weight of 426.48 g/mol, XLogP of 3.04, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]-1H-quinoline-4-carboxamide is sourced from PubChem (CID 2511656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).