C14H12BrNO4S — CID 25117001
methyl 3-[[2-(4-bromophenoxy)acetyl]amino]thiophene-2-carboxylate (PubChem CID 25117001) has the molecular formula C14H12BrNO4S and a molecular weight of 370.22 g/mol. Its IUPAC name is methyl 3-[[2-(4-bromophenoxy)acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(4-bromophenoxy)acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 25117001 |
| Molecular Formula | C14H12BrNO4S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | methyl 3-[[2-(4-bromophenoxy)acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12BrNO4S/c1-19-14(18)13-11(6-7-21-13)16-12(17)8-20-10-4-2-9(15)3-5-10/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | RKBGWJRBUXCRIC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |