C22H27FN2O5S — CID 25117928
1-[(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-fluorophenyl)-4-methylimidazole-2-thione (PubChem CID 25117928) has the molecular formula C22H27FN2O5S and a molecular weight of 450.53 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-fluorophenyl)-4-methylimidazole-2-thione.
| Compound Name | 1-[(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-fluorophenyl)-4-methylimidazole-2-thione |
|---|---|
| PubChem CID | 25117928 |
| Molecular Formula | C22H27FN2O5S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1-[(3aR,5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-fluorophenyl)-4-methylimidazole-2-thione |
| SMILES | Cc1cn([C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]2[C@H]2COC(C)(C)O2)c(=S)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FN2O5S/c1-12-10-24(20(31)25(12)14-8-6-13(23)7-9-14)16-17(15-11-26-21(2,3)28-15)27-19-18(16)29-22(4,5)30-19/h6-10,15-19H,11H2,1-5H3/t15-,16+,17-,18-,19-/m1/s1 |
| InChIKey | SDQKCNHKSQDJRS-RHQZKXFESA-N |
| XLogP | 4.02 |
| TPSA | 56.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|