C12H15NS — CID 25118
2-(1-benzothiophen-3-yl)-N,N-dimethylethanamine (PubChem CID 25118) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(1-benzothiophen-3-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 25118 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1csc2ccccc12 |
| InChI | InChI=1S/C12H15NS/c1-13(2)8-7-10-9-14-12-6-4-3-5-11(10)12/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | QAPUMUJBYRYLGE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |