About 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide
2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide (PubChem CID 25118465) has the molecular formula C12H11F3N2O4
and a molecular weight of 304.22 g/mol. Its IUPAC name is 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide |
| PubChem CID | 25118465 |
| Molecular Formula | C12H11F3N2O4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide |
| SMILES | NC(=O)C(=O)N1CCOc2ccc(OC(F)(F)F)cc2C1 |
| InChI | InChI=1S/C12H11F3N2O4/c13-12(14,15)21-8-1-2-9-7(5-8)6-17(3-4-20-9)11(19)10(16)18/h1-2,5H,3-4,6H2,(H2,16,18) |
| InChIKey | JRCIDSCBJMTYJM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide?
The IUPAC name of 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide (CID 25118465) is 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide.
What is the SMILES notation for 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide?
The canonical SMILES for 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide is NC(=O)C(=O)N1CCOc2ccc(OC(F)(F)F)cc2C1.
What is the InChIKey of 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide?
The InChIKey is JRCIDSCBJMTYJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2O4/c13-12(14,15)21-8-1-2-9-7(5-8)6-17(3-4-20-9)11(19)10(16)18/h1-2,5H,3-4,6H2,(H2,16,18).
What are the key properties of 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide?
2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide has a molecular weight of 304.22 g/mol, XLogP of 0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-[7-(trifluoromethoxy)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide is sourced from PubChem (CID 25118465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).