C30H51N3O2Si — CID 25119044
tert-butyl-dimethyl-[[(2R)-2,5,7,8-tetramethyl-2-[9-(triazol-2-yl)nonyl]-3,4-dihydrochromen-6-yl]oxy]silane (PubChem CID 25119044) has the molecular formula C30H51N3O2Si and a molecular weight of 513.84 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R)-2,5,7,8-tetramethyl-2-[9-(triazol-2-yl)nonyl]-3,4-dihydrochromen-6-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R)-2,5,7,8-tetramethyl-2-[9-(triazol-2-yl)nonyl]-3,4-dihydrochromen-6-yl]oxy]silane |
|---|---|
| PubChem CID | 25119044 |
| Molecular Formula | C30H51N3O2Si |
| Molecular Weight | 513.84 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R)-2,5,7,8-tetramethyl-2-[9-(triazol-2-yl)nonyl]-3,4-dihydrochromen-6-yl]oxy]silane |
| SMILES | Cc1c(C)c2c(c(C)c1O[Si](C)(C)C(C)(C)C)CC[C@@](C)(CCCCCCCCCn1nccn1)O2 |
| InChI | InChI=1S/C30H51N3O2Si/c1-23-24(2)28-26(25(3)27(23)35-36(8,9)29(4,5)6)17-19-30(7,34-28)18-15-13-11-10-12-14-16-22-33-31-20-21-32-33/h20-21H,10-19,22H2,1-9H3/t30-/m1/s1 |
| InChIKey | FHPKYSRRCYYOQG-SSEXGKCCSA-N |
| XLogP | 8.49 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.84 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|