C36H40FN3O6S — CID 25119537
[4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]-3-methoxyphenyl] 3-(benzylamino)propane-1-sulfonate (PubChem CID 25119537) has the molecular formula C36H40FN3O6S and a molecular weight of 661.80 g/mol. Its IUPAC name is [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]-3-methoxyphenyl] 3-(benzylamino)propane-1-sulfonate.
| Compound Name | [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]-3-methoxyphenyl] 3-(benzylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 25119537 |
| Molecular Formula | C36H40FN3O6S |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.26 |
| IUPAC Name | [4-[5-[(5-fluoro-2-methylphenoxy)methyl]-2,2,4-trimethyl-3-oxo-1H-quinoxalin-6-yl]-3-methoxyphenyl] 3-(benzylamino)propane-1-sulfonate |
| SMILES | COc1cc(OS(=O)(=O)CCCNCc2ccccc2)ccc1-c1ccc2c(c1COc1cc(F)ccc1C)N(C)C(=O)C(C)(C)N2 |
| InChI | InChI=1S/C36H40FN3O6S/c1-24-12-13-26(37)20-32(24)45-23-30-28(16-17-31-34(30)40(4)35(41)36(2,3)39-31)29-15-14-27(21-33(29)44-5)46-47(42,43)19-9-18-38-22-25-10-7-6-8-11-25/h6-8,10-17,20-21,38-39H,9,18-19,22-23H2,1-5H3 |
| InChIKey | ZROMEIRTRUJQRY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|