C18H26O6S — CID 25119749
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl 2-methylbutanoate (PubChem CID 25119749) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl 2-methylbutanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl 2-methylbutanoate |
|---|---|
| PubChem CID | 25119749 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-methylphenyl)sulfanyloxan-2-yl]methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC[C@H]1O[C@@H](Sc2ccc(C)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H26O6S/c1-4-11(3)17(22)23-9-13-14(19)15(20)16(21)18(24-13)25-12-7-5-10(2)6-8-12/h5-8,11,13-16,18-21H,4,9H2,1-3H3/t11?,13-,14-,15+,16-,18+/m1/s1 |
| InChIKey | WAGNOKCSGUHGKO-TUKSWJKHSA-N |
| XLogP | 1.48 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |