About 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea
1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea (PubChem CID 25119847) has the molecular formula C9H15FN4O
and a molecular weight of 214.24 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea.
Molecular Properties
| Compound Name | 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea |
| PubChem CID | 25119847 |
| Molecular Formula | C9H15FN4O |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea |
| SMILES | Cc1cc(CNC(=O)NCCF)nn1C |
| InChI | InChI=1S/C9H15FN4O/c1-7-5-8(13-14(7)2)6-12-9(15)11-4-3-10/h5H,3-4,6H2,1-2H3,(H2,11,12,15) |
| InChIKey | MDBNJNFKUNJEJZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea?
The IUPAC name of 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea (CID 25119847) is 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea.
What is the SMILES notation for 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea?
The canonical SMILES for 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea is Cc1cc(CNC(=O)NCCF)nn1C.
What is the InChIKey of 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea?
The InChIKey is MDBNJNFKUNJEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15FN4O/c1-7-5-8(13-14(7)2)6-12-9(15)11-4-3-10/h5H,3-4,6H2,1-2H3,(H2,11,12,15).
What are the key properties of 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea?
1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea has a molecular weight of 214.24 g/mol, XLogP of 0.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,5-dimethylpyrazol-3-yl)methyl]-3-(2-fluoroethyl)urea is sourced from PubChem (CID 25119847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).