C20H21FN4O3 — CID 25119978
N-[2-[ethyl(methyl)amino]-7-fluoro-4-oxoquinazolin-3-yl]-2-(4-methoxyphenyl)acetamide (PubChem CID 25119978) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is N-[2-[ethyl(methyl)amino]-7-fluoro-4-oxoquinazolin-3-yl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[2-[ethyl(methyl)amino]-7-fluoro-4-oxoquinazolin-3-yl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 25119978 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[2-[ethyl(methyl)amino]-7-fluoro-4-oxoquinazolin-3-yl]-2-(4-methoxyphenyl)acetamide |
| SMILES | CCN(C)c1nc2cc(F)ccc2c(=O)n1NC(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H21FN4O3/c1-4-24(2)20-22-17-12-14(21)7-10-16(17)19(27)25(20)23-18(26)11-13-5-8-15(28-3)9-6-13/h5-10,12H,4,11H2,1-3H3,(H,23,26) |
| InChIKey | SSFWAQGUCFKXQZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |