C22H18N2O10 — CID 25120032
4-[13-(3-carboxy-2-hydroxypropyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-3-hydroxybutanoic acid (PubChem CID 25120032) has the molecular formula C22H18N2O10 and a molecular weight of 470.39 g/mol. Its IUPAC name is 4-[13-(3-carboxy-2-hydroxypropyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-3-hydroxybutanoic acid.
| Compound Name | 4-[13-(3-carboxy-2-hydroxypropyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 25120032 |
| Molecular Formula | C22H18N2O10 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 4-[13-(3-carboxy-2-hydroxypropyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-3-hydroxybutanoic acid |
| SMILES | O=C(O)CC(O)CN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CC(O)CC(=O)O)C3=O |
| InChI | InChI=1S/C22H18N2O10/c25-9(5-15(27)28)7-23-19(31)11-1-2-12-18-14(4-3-13(17(11)18)21(23)33)22(34)24(20(12)32)8-10(26)6-16(29)30/h1-4,9-10,25-26H,5-8H2,(H,27,28)(H,29,30) |
| InChIKey | RWJVTGPRDCVJNR-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 189.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|