C20H19F3N6O — CID 25120171
3-[[8-[(pyridin-2-ylamino)methyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol (PubChem CID 25120171) has the molecular formula C20H19F3N6O and a molecular weight of 416.41 g/mol. Its IUPAC name is 3-[[8-[(pyridin-2-ylamino)methyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[8-[(pyridin-2-ylamino)methyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 25120171 |
| Molecular Formula | C20H19F3N6O |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 3-[[8-[(pyridin-2-ylamino)methyl]-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nc2cc(C(F)(F)F)c(CNc3ccccn3)cc2n2ccnc12 |
| InChI | InChI=1S/C20H19F3N6O/c21-20(22,23)14-11-15-16(10-13(14)12-27-17-4-1-2-5-24-17)29-8-7-26-19(29)18(28-15)25-6-3-9-30/h1-2,4-5,7-8,10-11,30H,3,6,9,12H2,(H,24,27)(H,25,28) |
| InChIKey | UAWRIFNMXONCOI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|