C21H29NO6 — CID 25120408
N-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenylpropanamide (PubChem CID 25120408) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is N-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenylpropanamide.
| Compound Name | N-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 25120408 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-phenylpropanamide |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@@H](NC(=O)CCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C21H29NO6/c1-20(2)24-12-14(26-20)17-16(18-19(25-17)28-21(3,4)27-18)22-15(23)11-10-13-8-6-5-7-9-13/h5-9,14,16-19H,10-12H2,1-4H3,(H,22,23)/t14-,16-,17-,18-,19-/m1/s1 |
| InChIKey | XYVHFSCJQGGGHE-WSIUPNEHSA-N |
| XLogP | 2.13 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |