C25H26O5 — CID 25120528
3,5-bis[(4-ethoxyphenyl)methoxy]benzaldehyde (PubChem CID 25120528) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3,5-bis[(4-ethoxyphenyl)methoxy]benzaldehyde.
| Compound Name | 3,5-bis[(4-ethoxyphenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 25120528 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 3,5-bis[(4-ethoxyphenyl)methoxy]benzaldehyde |
| SMILES | CCOc1ccc(COc2cc(C=O)cc(OCc3ccc(OCC)cc3)c2)cc1 |
| InChI | InChI=1S/C25H26O5/c1-3-27-22-9-5-19(6-10-22)17-29-24-13-21(16-26)14-25(15-24)30-18-20-7-11-23(12-8-20)28-4-2/h5-16H,3-4,17-18H2,1-2H3 |
| InChIKey | OZQYOMAZAJWGNP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|